C26H20O8 — CID 19931686
(3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone;(3,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone (PubChem CID 19931686) has the molecular formula C26H20O8 and a molecular weight of 460.44 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone;(3,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone.
| Compound Name | (3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone;(3,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 19931686 |
| Molecular Formula | C26H20O8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (3,4-dihydroxyphenyl)-(3-hydroxyphenyl)methanone;(3,4-dihydroxyphenyl)-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)c1ccc(O)c(O)c1.O=C(c1cccc(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/2C13H10O4/c14-10-4-1-8(2-5-10)13(17)9-3-6-11(15)12(16)7-9;14-10-3-1-2-8(6-10)13(17)9-4-5-11(15)12(16)7-9/h2*1-7,14-16H |
| InChIKey | QRBUOWFGUMAIQA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|