C13H8Cl2O2 — CID 12639783
(3,4-dichlorophenyl)-(3-hydroxyphenyl)methanone (PubChem CID 12639783) has the molecular formula C13H8Cl2O2 and a molecular weight of 267.11 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3-hydroxyphenyl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 12639783 |
| Molecular Formula | C13H8Cl2O2 |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | (3,4-dichlorophenyl)-(3-hydroxyphenyl)methanone |
| SMILES | O=C(c1cccc(O)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2O2/c14-11-5-4-9(7-12(11)15)13(17)8-2-1-3-10(16)6-8/h1-7,16H |
| InChIKey | USCNAMXMLGDKMW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |