C14H10O4 — CID 13158606
1,2-bis(3-hydroxyphenyl)ethane-1,2-dione (PubChem CID 13158606) has the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 1,2-bis(3-hydroxyphenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(3-hydroxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 13158606 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1,2-bis(3-hydroxyphenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cccc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C14H10O4/c15-11-5-1-3-9(7-11)13(17)14(18)10-4-2-6-12(16)8-10/h1-8,15-16H |
| InChIKey | NRVBEDFRJZDULS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|