About acetic acid;3-prop-1-en-2-ylphenol
acetic acid;3-prop-1-en-2-ylphenol (PubChem CID 71365863) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is acetic acid;3-prop-1-en-2-ylphenol.
Molecular Properties
| Compound Name | acetic acid;3-prop-1-en-2-ylphenol |
| PubChem CID | 71365863 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | acetic acid;3-prop-1-en-2-ylphenol |
| SMILES | C=C(C)c1cccc(O)c1.CC(=O)O |
| InChI | InChI=1S/C9H10O.C2H4O2/c1-7(2)8-4-3-5-9(10)6-8;1-2(3)4/h3-6,10H,1H2,2H3;1H3,(H,3,4) |
| InChIKey | AXISMUINTMGGMV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;3-prop-1-en-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-prop-1-en-2-ylphenol?
The IUPAC name of acetic acid;3-prop-1-en-2-ylphenol (CID 71365863) is acetic acid;3-prop-1-en-2-ylphenol.
What is the SMILES notation for acetic acid;3-prop-1-en-2-ylphenol?
The canonical SMILES for acetic acid;3-prop-1-en-2-ylphenol is C=C(C)c1cccc(O)c1.CC(=O)O.
What is the InChIKey of acetic acid;3-prop-1-en-2-ylphenol?
The InChIKey is AXISMUINTMGGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C2H4O2/c1-7(2)8-4-3-5-9(10)6-8;1-2(3)4/h3-6,10H,1H2,2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-prop-1-en-2-ylphenol?
acetic acid;3-prop-1-en-2-ylphenol has a molecular weight of 194.23 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-prop-1-en-2-ylphenol is sourced from PubChem (CID 71365863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).