C24H30O14 — CID 158588762
benzene-1,3-diol;hexakis(prop-2-enoic acid) (PubChem CID 158588762) has the molecular formula C24H30O14 and a molecular weight of 542.49 g/mol. Its IUPAC name is benzene-1,3-diol;hexakis(prop-2-enoic acid).
| Compound Name | benzene-1,3-diol;hexakis(prop-2-enoic acid) |
|---|---|
| PubChem CID | 158588762 |
| Molecular Formula | C24H30O14 |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | benzene-1,3-diol;hexakis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.6C3H4O2/c7-5-2-1-3-6(8)4-5;6*1-2-3(4)5/h1-4,7-8H;6*2H,1H2,(H,4,5) |
| InChIKey | HUEAERYWZOBAIN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 264.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|