About benzene-1,3-diol;formaldehyde;silver
benzene-1,3-diol;formaldehyde;silver (PubChem CID 174852688) has the molecular formula C7H8AgO3
and a molecular weight of 248.01 g/mol. Its IUPAC name is benzene-1,3-diol;formaldehyde;silver.
Molecular Properties
| Compound Name | benzene-1,3-diol;formaldehyde;silver |
| PubChem CID | 174852688 |
| Molecular Formula | C7H8AgO3 |
| Molecular Weight | 248.01 g/mol |
| Exact Mass | 246.95 |
| IUPAC Name | benzene-1,3-diol;formaldehyde;silver |
| SMILES | C=O.Oc1cccc(O)c1.[Ag] |
| InChI | InChI=1S/C6H6O2.CH2O.Ag/c7-5-2-1-3-6(8)4-5;1-2;/h1-4,7-8H;1H2; |
| InChIKey | DTUOYDPMPUHRDY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.01 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene-1,3-diol;formaldehyde;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;formaldehyde;silver?
The IUPAC name of benzene-1,3-diol;formaldehyde;silver (CID 174852688) is benzene-1,3-diol;formaldehyde;silver.
What is the SMILES notation for benzene-1,3-diol;formaldehyde;silver?
The canonical SMILES for benzene-1,3-diol;formaldehyde;silver is C=O.Oc1cccc(O)c1.[Ag].
What is the InChIKey of benzene-1,3-diol;formaldehyde;silver?
The InChIKey is DTUOYDPMPUHRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.CH2O.Ag/c7-5-2-1-3-6(8)4-5;1-2;/h1-4,7-8H;1H2;.
What are the key properties of benzene-1,3-diol;formaldehyde;silver?
benzene-1,3-diol;formaldehyde;silver has a molecular weight of 248.01 g/mol, XLogP of 0.91, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;formaldehyde;silver is sourced from PubChem (CID 174852688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).