C6H12O10P2 — CID 87069465
benzene-1,3-diol;phosphoric acid (PubChem CID 87069465) has the molecular formula C6H12O10P2 and a molecular weight of 306.10 g/mol. Its IUPAC name is benzene-1,3-diol;phosphoric acid.
| Compound Name | benzene-1,3-diol;phosphoric acid |
|---|---|
| PubChem CID | 87069465 |
| Molecular Formula | C6H12O10P2 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | benzene-1,3-diol;phosphoric acid |
| SMILES | O=P(O)(O)O.O=P(O)(O)O.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.2H3O4P/c7-5-2-1-3-6(8)4-5;2*1-5(2,3)4/h1-4,7-8H;2*(H3,1,2,3,4) |
| InChIKey | UOYVDHYHTPDWJD-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|