About benzene-1,3-diol;phenol
benzene-1,3-diol;phenol (PubChem CID 23218590) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is benzene-1,3-diol;phenol.
Molecular Properties
| Compound Name | benzene-1,3-diol;phenol |
| PubChem CID | 23218590 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | benzene-1,3-diol;phenol |
| SMILES | Oc1cccc(O)c1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O2.2C6H6O/c7-5-2-1-3-6(8)4-5;2*7-6-4-2-1-3-5-6/h1-4,7-8H;2*1-5,7H |
| InChIKey | GREFHIDGEPDFSX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzene-1,3-diol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;phenol?
The IUPAC name of benzene-1,3-diol;phenol (CID 23218590) is benzene-1,3-diol;phenol.
What is the SMILES notation for benzene-1,3-diol;phenol?
The canonical SMILES for benzene-1,3-diol;phenol is Oc1cccc(O)c1.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of benzene-1,3-diol;phenol?
The InChIKey is GREFHIDGEPDFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.2C6H6O/c7-5-2-1-3-6(8)4-5;2*7-6-4-2-1-3-5-6/h1-4,7-8H;2*1-5,7H.
What are the key properties of benzene-1,3-diol;phenol?
benzene-1,3-diol;phenol has a molecular weight of 298.34 g/mol, XLogP of 3.88, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;phenol is sourced from PubChem (CID 23218590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).