About benzene-1,3-diol;tris(yttrium)
benzene-1,3-diol;tris(yttrium) (PubChem CID 23386139) has the molecular formula C6H6O2Y3
and a molecular weight of 376.83 g/mol. Its IUPAC name is benzene-1,3-diol;tris(yttrium).
Molecular Properties
| Compound Name | benzene-1,3-diol;tris(yttrium) |
| PubChem CID | 23386139 |
| Molecular Formula | C6H6O2Y3 |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.75 |
| IUPAC Name | benzene-1,3-diol;tris(yttrium) |
| SMILES | Oc1cccc(O)c1.[Y].[Y].[Y] |
| InChI | InChI=1S/C6H6O2.3Y/c7-5-2-1-3-6(8)4-5;;;/h1-4,7-8H;;; |
| InChIKey | JBCNXWKGHMKHQC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene-1,3-diol;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;tris(yttrium)?
The IUPAC name of benzene-1,3-diol;tris(yttrium) (CID 23386139) is benzene-1,3-diol;tris(yttrium).
What is the SMILES notation for benzene-1,3-diol;tris(yttrium)?
The canonical SMILES for benzene-1,3-diol;tris(yttrium) is Oc1cccc(O)c1.[Y].[Y].[Y].
What is the InChIKey of benzene-1,3-diol;tris(yttrium)?
The InChIKey is JBCNXWKGHMKHQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.3Y/c7-5-2-1-3-6(8)4-5;;;/h1-4,7-8H;;;.
What are the key properties of benzene-1,3-diol;tris(yttrium)?
benzene-1,3-diol;tris(yttrium) has a molecular weight of 376.83 g/mol, XLogP of 1.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;tris(yttrium) is sourced from PubChem (CID 23386139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).