C12H14N2O2 — CID 67778876
benzene-1,2-diamine;benzene-1,3-diol (PubChem CID 67778876) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is benzene-1,2-diamine;benzene-1,3-diol.
| Compound Name | benzene-1,2-diamine;benzene-1,3-diol |
|---|---|
| PubChem CID | 67778876 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | benzene-1,2-diamine;benzene-1,3-diol |
| SMILES | Nc1ccccc1N.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H8N2.C6H6O2/c7-5-3-1-2-4-6(5)8;7-5-2-1-3-6(8)4-5/h1-4H,7-8H2;1-4,7-8H |
| InChIKey | DKCQMFBQANDAMR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|