C14H19NO3 — CID 142022536
3-aminophenol;benzene-1,3-diol;ethane (PubChem CID 142022536) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-aminophenol;benzene-1,3-diol;ethane.
| Compound Name | 3-aminophenol;benzene-1,3-diol;ethane |
|---|---|
| PubChem CID | 142022536 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-aminophenol;benzene-1,3-diol;ethane |
| SMILES | CC.Nc1cccc(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H7NO.C6H6O2.C2H6/c2*7-5-2-1-3-6(8)4-5;1-2/h1-4,8H,7H2;1-4,7-8H;1-2H3 |
| InChIKey | JPYYIVICDBHWPM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|