About 3-aminophenol;3-tert-butylphenol;formaldehyde
3-aminophenol;3-tert-butylphenol;formaldehyde (PubChem CID 67925508) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-aminophenol;3-tert-butylphenol;formaldehyde.
Molecular Properties
| Compound Name | 3-aminophenol;3-tert-butylphenol;formaldehyde |
| PubChem CID | 67925508 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-aminophenol;3-tert-butylphenol;formaldehyde |
| SMILES | C=O.CC(C)(C)c1cccc(O)c1.Nc1cccc(O)c1 |
| InChI | InChI=1S/C10H14O.C6H7NO.CH2O/c1-10(2,3)8-5-4-6-9(11)7-8;7-5-2-1-3-6(8)4-5;1-2/h4-7,11H,1-3H3;1-4,8H,7H2;1H2 |
| InChIKey | GQUAMOAAGHFFFJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminophenol;3-tert-butylphenol;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminophenol;3-tert-butylphenol;formaldehyde?
The IUPAC name of 3-aminophenol;3-tert-butylphenol;formaldehyde (CID 67925508) is 3-aminophenol;3-tert-butylphenol;formaldehyde.
What is the SMILES notation for 3-aminophenol;3-tert-butylphenol;formaldehyde?
The canonical SMILES for 3-aminophenol;3-tert-butylphenol;formaldehyde is C=O.CC(C)(C)c1cccc(O)c1.Nc1cccc(O)c1.
What is the InChIKey of 3-aminophenol;3-tert-butylphenol;formaldehyde?
The InChIKey is GQUAMOAAGHFFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C6H7NO.CH2O/c1-10(2,3)8-5-4-6-9(11)7-8;7-5-2-1-3-6(8)4-5;1-2/h4-7,11H,1-3H3;1-4,8H,7H2;1H2.
What are the key properties of 3-aminophenol;3-tert-butylphenol;formaldehyde?
3-aminophenol;3-tert-butylphenol;formaldehyde has a molecular weight of 289.38 g/mol, XLogP of 3.48, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminophenol;3-tert-butylphenol;formaldehyde is sourced from PubChem (CID 67925508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).