About 3-tert-butylaniline;tert-butylbenzene
3-tert-butylaniline;tert-butylbenzene (PubChem CID 158494400) has the molecular formula C20H29N
and a molecular weight of 283.46 g/mol. Its IUPAC name is 3-tert-butylaniline;tert-butylbenzene.
Molecular Properties
| Compound Name | 3-tert-butylaniline;tert-butylbenzene |
| PubChem CID | 158494400 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 3-tert-butylaniline;tert-butylbenzene |
| SMILES | CC(C)(C)c1cccc(N)c1.CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C10H15N.C10H14/c1-10(2,3)8-5-4-6-9(11)7-8;1-10(2,3)9-7-5-4-6-8-9/h4-7H,11H2,1-3H3;4-8H,1-3H3 |
| InChIKey | HJCDUYHSXVAVEE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butylaniline;tert-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butylaniline;tert-butylbenzene?
The IUPAC name of 3-tert-butylaniline;tert-butylbenzene (CID 158494400) is 3-tert-butylaniline;tert-butylbenzene.
What is the SMILES notation for 3-tert-butylaniline;tert-butylbenzene?
The canonical SMILES for 3-tert-butylaniline;tert-butylbenzene is CC(C)(C)c1cccc(N)c1.CC(C)(C)c1ccccc1.
What is the InChIKey of 3-tert-butylaniline;tert-butylbenzene?
The InChIKey is HJCDUYHSXVAVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C10H14/c1-10(2,3)8-5-4-6-9(11)7-8;1-10(2,3)9-7-5-4-6-8-9/h4-7H,11H2,1-3H3;4-8H,1-3H3.
What are the key properties of 3-tert-butylaniline;tert-butylbenzene?
3-tert-butylaniline;tert-butylbenzene has a molecular weight of 283.46 g/mol, XLogP of 5.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butylaniline;tert-butylbenzene is sourced from PubChem (CID 158494400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).