C19H26 — CID 173429948
tert-butylbenzene;1,3,5-trimethylbenzene (PubChem CID 173429948) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is tert-butylbenzene;1,3,5-trimethylbenzene.
| Compound Name | tert-butylbenzene;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 173429948 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | tert-butylbenzene;1,3,5-trimethylbenzene |
| SMILES | CC(C)(C)c1ccccc1.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C10H14.C9H12/c1-10(2,3)9-7-5-4-6-8-9;1-7-4-8(2)6-9(3)5-7/h4-8H,1-3H3;4-6H,1-3H3 |
| InChIKey | SFTDQUAPUOVXLG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |