C22H32 — CID 165052129
tert-butylbenzene;1-tert-butyl-3,5-dimethylbenzene (PubChem CID 165052129) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is tert-butylbenzene;1-tert-butyl-3,5-dimethylbenzene.
| Compound Name | tert-butylbenzene;1-tert-butyl-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 165052129 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butylbenzene;1-tert-butyl-3,5-dimethylbenzene |
| SMILES | CC(C)(C)c1ccccc1.Cc1cc(C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18.C10H14/c1-9-6-10(2)8-11(7-9)12(3,4)5;1-10(2,3)9-7-5-4-6-8-9/h6-8H,1-5H3;4-8H,1-3H3 |
| InChIKey | PVCMJGRQUOZJDX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |