C12H18 — CID 165028726
1-tert-butyl-3-methyl-5-(trideuteriomethyl)benzene (PubChem CID 165028726) has the molecular formula C12H18 and a molecular weight of 165.29 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-5-(trideuteriomethyl)benzene.
| Compound Name | 1-tert-butyl-3-methyl-5-(trideuteriomethyl)benzene |
|---|---|
| PubChem CID | 165028726 |
| Molecular Formula | C12H18 |
| Molecular Weight | 165.29 g/mol |
| Exact Mass | 165.16 |
| IUPAC Name | 1-tert-butyl-3-methyl-5-(trideuteriomethyl)benzene |
| SMILES | [2H]C([2H])([2H])c1cc(C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18/c1-9-6-10(2)8-11(7-9)12(3,4)5/h6-8H,1-5H3/i1D3 |
| InChIKey | FZSPYHREEHYLCB-FIBGUPNXSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |