C24H34I+ — CID 175898268
bis[4-tert-butyl-2,6-bis(trideuteriomethyl)phenyl]iodanium (PubChem CID 175898268) has the molecular formula C24H34I+ and a molecular weight of 461.51 g/mol. Its IUPAC name is bis[4-tert-butyl-2,6-bis(trideuteriomethyl)phenyl]iodanium.
| Compound Name | bis[4-tert-butyl-2,6-bis(trideuteriomethyl)phenyl]iodanium |
|---|---|
| PubChem CID | 175898268 |
| Molecular Formula | C24H34I+ |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | bis[4-tert-butyl-2,6-bis(trideuteriomethyl)phenyl]iodanium |
| SMILES | [2H]C([2H])([2H])c1cc(C(C)(C)C)cc(C([2H])([2H])[2H])c1[I+]c1c(C([2H])([2H])[2H])cc(C(C)(C)C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C24H34I/c1-15-11-19(23(5,6)7)12-16(2)21(15)25-22-17(3)13-20(14-18(22)4)24(8,9)10/h11-14H,1-10H3/q+1/i1D3,2D3,3D3,4D3 |
| InChIKey | CMHQWSVZOUHPHX-MGKWXGLJSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|