C36H60Tb — CID 134902614
terbium;bis(1,3,5-tritert-butylbenzene) (PubChem CID 134902614) has the molecular formula C36H60Tb and a molecular weight of 651.80 g/mol. Its IUPAC name is terbium;bis(1,3,5-tritert-butylbenzene).
| Compound Name | terbium;bis(1,3,5-tritert-butylbenzene) |
|---|---|
| PubChem CID | 134902614 |
| Molecular Formula | C36H60Tb |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.39 |
| IUPAC Name | terbium;bis(1,3,5-tritert-butylbenzene) |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1.CC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1.[Tb] |
| InChI | InChI=1S/2C18H30.Tb/c2*1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9;/h2*10-12H,1-9H3; |
| InChIKey | WKIHYYPJHGIHOA-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |