C15H21N — CID 3682565
3,5-ditert-butylbenzonitrile (PubChem CID 3682565) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3,5-ditert-butylbenzonitrile.
| Compound Name | 3,5-ditert-butylbenzonitrile |
|---|---|
| PubChem CID | 3682565 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3,5-ditert-butylbenzonitrile |
| SMILES | CC(C)(C)c1cc(C#N)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H21N/c1-14(2,3)12-7-11(10-16)8-13(9-12)15(4,5)6/h7-9H,1-6H3 |
| InChIKey | VAPUHUILPPYYEL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |