C30H40N2 — CID 67297974
3,5-ditert-butyl-4-(2,6-ditert-butyl-4-cyanophenyl)benzonitrile (PubChem CID 67297974) has the molecular formula C30H40N2 and a molecular weight of 428.66 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-(2,6-ditert-butyl-4-cyanophenyl)benzonitrile.
| Compound Name | 3,5-ditert-butyl-4-(2,6-ditert-butyl-4-cyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 67297974 |
| Molecular Formula | C30H40N2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 3,5-ditert-butyl-4-(2,6-ditert-butyl-4-cyanophenyl)benzonitrile |
| SMILES | CC(C)(C)c1cc(C#N)cc(C(C)(C)C)c1-c1c(C(C)(C)C)cc(C#N)cc1C(C)(C)C |
| InChI | InChI=1S/C30H40N2/c1-27(2,3)21-13-19(17-31)14-22(28(4,5)6)25(21)26-23(29(7,8)9)15-20(18-32)16-24(26)30(10,11)12/h13-16H,1-12H3 |
| InChIKey | RVNAUJWUHAZQGF-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |