C19H21N — CID 38764
(1,1'-Biphenyl)-4-carbonitrile, 4'-hexyl- (PubChem CID 38764) has the molecular formula C19H21N and a molecular weight of 263.40 g/mol. Its IUPAC name is 4-(4-hexylphenyl)benzonitrile.
| Compound Name | (1,1'-Biphenyl)-4-carbonitrile, 4'-hexyl- |
|---|---|
| PubChem CID | 38764 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-(4-hexylphenyl)benzonitrile |
| SMILES | CCCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
| InChI | InChI=1S/C19H21N/c1-2-3-4-5-6-16-7-11-18(12-8-16)19-13-9-17(15-20)10-14-19/h7-14H,2-6H2,1H3 |
| InChIKey | VADSDVGLFDVIMG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 297 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|