About 4-methylbenzonitrile
4-methylbenzonitrile (PubChem CID 7724) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is 4-methylbenzonitrile.
Molecular Properties
| Compound Name | 4-methylbenzonitrile |
| PubChem CID | 7724 |
| Molecular Formula | C8H7N |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C8H7N/c1-7-2-4-8(6-9)5-3-7/h2-5H,1H3 |
| InChIKey | VCZNNAKNUVJVGX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzonitrile?
The IUPAC name of 4-methylbenzonitrile (CID 7724) is 4-methylbenzonitrile.
What is the SMILES notation for 4-methylbenzonitrile?
The canonical SMILES for 4-methylbenzonitrile is Cc1ccc(C#N)cc1.
What is the InChIKey of 4-methylbenzonitrile?
The InChIKey is VCZNNAKNUVJVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N/c1-7-2-4-8(6-9)5-3-7/h2-5H,1H3.
What are the key properties of 4-methylbenzonitrile?
4-methylbenzonitrile has a molecular weight of 117.15 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzonitrile is sourced from PubChem (CID 7724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).