About 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile
3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile (PubChem CID 67297904) has the molecular formula C32H44N2
and a molecular weight of 456.72 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile |
| PubChem CID | 67297904 |
| Molecular Formula | C32H44N2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile |
| SMILES | CC(C)(C)c1cc(C#N)cc(C(C)(C)C)c1CCc1c(C(C)(C)C)cc(C#N)cc1C(C)(C)C |
| InChI | InChI=1S/C32H44N2/c1-29(2,3)25-15-21(19-33)16-26(30(4,5)6)23(25)13-14-24-27(31(7,8)9)17-22(20-34)18-28(24)32(10,11)12/h15-18H,13-14H2,1-12H3 |
| InChIKey | FOHHGFAEFGVPIK-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile?
The IUPAC name of 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile (CID 67297904) is 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile.
What is the SMILES notation for 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile?
The canonical SMILES for 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile is CC(C)(C)c1cc(C#N)cc(C(C)(C)C)c1CCc1c(C(C)(C)C)cc(C#N)cc1C(C)(C)C.
What is the InChIKey of 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile?
The InChIKey is FOHHGFAEFGVPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H44N2/c1-29(2,3)25-15-21(19-33)16-26(30(4,5)6)23(25)13-14-24-27(31(7,8)9)17-22(20-34)18-28(24)32(10,11)12/h15-18H,13-14H2,1-12H3.
What are the key properties of 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile?
3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile has a molecular weight of 456.72 g/mol, XLogP of 8.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-4-[2-(2,6-ditert-butyl-4-cyanophenyl)ethyl]benzonitrile is sourced from PubChem (CID 67297904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).