C16H22N2O2 — CID 58902321
tert-butyl N-(3-tert-butyl-5-cyanophenyl)carbamate (PubChem CID 58902321) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is tert-butyl N-(3-tert-butyl-5-cyanophenyl)carbamate.
| Compound Name | tert-butyl N-(3-tert-butyl-5-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 58902321 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | tert-butyl N-(3-tert-butyl-5-cyanophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C#N)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-15(2,3)12-7-11(10-17)8-13(9-12)18-14(19)20-16(4,5)6/h7-9H,1-6H3,(H,18,19) |
| InChIKey | FOTOGXIUHVNOLO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |