C25H25N3O4 — CID 178084282
tert-butyl N-[3-cyano-5-(4-phenoxyphenyl)phenyl]carbamate;formamide (PubChem CID 178084282) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl N-[3-cyano-5-(4-phenoxyphenyl)phenyl]carbamate;formamide.
| Compound Name | tert-butyl N-[3-cyano-5-(4-phenoxyphenyl)phenyl]carbamate;formamide |
|---|---|
| PubChem CID | 178084282 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | tert-butyl N-[3-cyano-5-(4-phenoxyphenyl)phenyl]carbamate;formamide |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C#N)cc(-c2ccc(Oc3ccccc3)cc2)c1.NC=O |
| InChI | InChI=1S/C24H22N2O3.CH3NO/c1-24(2,3)29-23(27)26-20-14-17(16-25)13-19(15-20)18-9-11-22(12-10-18)28-21-7-5-4-6-8-21;2-1-3/h4-15H,1-3H3,(H,26,27);1H,(H2,2,3) |
| InChIKey | ZFBZETJWOCRPFK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|