C34H30BrN2O2+ — CID 155772901
tert-butyl N-[4-[1-(4-bromophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]carbamate (PubChem CID 155772901) has the molecular formula C34H30BrN2O2+ and a molecular weight of 578.53 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(4-bromophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(4-bromophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 155772901 |
| Molecular Formula | C34H30BrN2O2+ |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | tert-butyl N-[4-[1-(4-bromophenyl)-2,6-diphenylpyridin-1-ium-4-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cc(-c3ccccc3)[n+](-c3ccc(Br)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H29BrN2O2/c1-34(2,3)39-33(38)36-29-18-14-24(15-19-29)27-22-31(25-10-6-4-7-11-25)37(30-20-16-28(35)17-21-30)32(23-27)26-12-8-5-9-13-26/h4-23H,1-3H3/p+1 |
| InChIKey | GTLDWRXEFPVQPD-UHFFFAOYSA-O |
| XLogP | 9.07 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|