About tert-butyl N-phenylcarbamate;ethane;molecular hydrogen
tert-butyl N-phenylcarbamate;ethane;molecular hydrogen (PubChem CID 143200199) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is tert-butyl N-phenylcarbamate;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | tert-butyl N-phenylcarbamate;ethane;molecular hydrogen |
| PubChem CID | 143200199 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | tert-butyl N-phenylcarbamate;ethane;molecular hydrogen |
| SMILES | CC.CC(C)(C)OC(=O)Nc1ccccc1.[H][H] |
| InChI | InChI=1S/C11H15NO2.C2H6.H2/c1-11(2,3)14-10(13)12-9-7-5-4-6-8-9;1-2;/h4-8H,1-3H3,(H,12,13);1-2H3;1H |
| InChIKey | AHLZONOKTWJYOF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-phenylcarbamate;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-phenylcarbamate;ethane;molecular hydrogen?
The IUPAC name of tert-butyl N-phenylcarbamate;ethane;molecular hydrogen (CID 143200199) is tert-butyl N-phenylcarbamate;ethane;molecular hydrogen.
What is the SMILES notation for tert-butyl N-phenylcarbamate;ethane;molecular hydrogen?
The canonical SMILES for tert-butyl N-phenylcarbamate;ethane;molecular hydrogen is CC.CC(C)(C)OC(=O)Nc1ccccc1.[H][H].
What is the InChIKey of tert-butyl N-phenylcarbamate;ethane;molecular hydrogen?
The InChIKey is AHLZONOKTWJYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C2H6.H2/c1-11(2,3)14-10(13)12-9-7-5-4-6-8-9;1-2;/h4-8H,1-3H3,(H,12,13);1-2H3;1H.
What are the key properties of tert-butyl N-phenylcarbamate;ethane;molecular hydrogen?
tert-butyl N-phenylcarbamate;ethane;molecular hydrogen has a molecular weight of 225.33 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-phenylcarbamate;ethane;molecular hydrogen is sourced from PubChem (CID 143200199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).