C11H15NO2S — CID 59412418
tert-butyl N-(4-sulfanylphenyl)carbamate (PubChem CID 59412418) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is tert-butyl N-(4-sulfanylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-sulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 59412418 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | tert-butyl N-(4-sulfanylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(S)cc1 |
| InChI | InChI=1S/C11H15NO2S/c1-11(2,3)14-10(13)12-8-4-6-9(15)7-5-8/h4-7,15H,1-3H3,(H,12,13) |
| InChIKey | YYZNFLXZNSOQHP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|