C11H14BF3KNO2 — CID 74787607
potassium trifluoro-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide (PubChem CID 74787607) has the molecular formula C11H14BF3KNO2 and a molecular weight of 299.14 g/mol. Its IUPAC name is potassium trifluoro-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide.
| Compound Name | potassium trifluoro-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide |
|---|---|
| PubChem CID | 74787607 |
| Molecular Formula | C11H14BF3KNO2 |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | potassium trifluoro-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide |
| SMILES | CC(C)(C)OC(=O)Nc1ccc([B-](F)(F)F)cc1.[K+] |
| InChI | InChI=1S/C11H14BF3NO2.K/c1-11(2,3)18-10(17)16-9-6-4-8(5-7-9)12(13,14)15;/h4-7H,1-3H3,(H,16,17);/q-1;+1 |
| InChIKey | YLSVHRQNDAWMMN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|