C11H13BF4NO2- — CID 86810523
trifluoro-[2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide (PubChem CID 86810523) has the molecular formula C11H13BF4NO2- and a molecular weight of 278.03 g/mol. Its IUPAC name is trifluoro-[2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide.
| Compound Name | trifluoro-[2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide |
|---|---|
| PubChem CID | 86810523 |
| Molecular Formula | C11H13BF4NO2- |
| Molecular Weight | 278.03 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | trifluoro-[2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boranuide |
| SMILES | CC(C)(C)OC(=O)Nc1ccc([B-](F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H13BF4NO2/c1-11(2,3)19-10(18)17-7-4-5-8(9(13)6-7)12(14,15)16/h4-6H,1-3H3,(H,17,18)/q-1 |
| InChIKey | PHHPNNAVCNHLCJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.03 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|