About 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (PubChem CID 176681654) has the molecular formula C18H17F2NO4
and a molecular weight of 349.33 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid.
Molecular Properties
| Compound Name | 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| PubChem CID | 176681654 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)O)c(-c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C18H17F2NO4/c1-18(2,3)25-17(24)21-11-5-6-12(16(22)23)13(9-11)14-8-10(19)4-7-15(14)20/h4-9H,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | HBGUCGWHKOYLAV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid?
The IUPAC name of 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CID 176681654) is 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid.
What is the SMILES notation for 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid?
The canonical SMILES for 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid is CC(C)(C)OC(=O)Nc1ccc(C(=O)O)c(-c2cc(F)ccc2F)c1.
What is the InChIKey of 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid?
The InChIKey is HBGUCGWHKOYLAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2NO4/c1-18(2,3)25-17(24)21-11-5-6-12(16(22)23)13(9-11)14-8-10(19)4-7-15(14)20/h4-9H,1-3H3,(H,21,24)(H,22,23).
What are the key properties of 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid?
2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid has a molecular weight of 349.33 g/mol, XLogP of 4.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid is sourced from PubChem (CID 176681654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).