C15H21FN2O3 — CID 9210708
tert-butyl N-[3-(3-fluoro-4-methylanilino)-3-oxopropyl]carbamate (PubChem CID 9210708) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is tert-butyl N-[3-(3-fluoro-4-methylanilino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-fluoro-4-methylanilino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 9210708 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | tert-butyl N-[3-(3-fluoro-4-methylanilino)-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(NC(=O)CCNC(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H21FN2O3/c1-10-5-6-11(9-12(10)16)18-13(19)7-8-17-14(20)21-15(2,3)4/h5-6,9H,7-8H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | GRFFDKAJQKNCTO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |