C24H31N3O4 — CID 108920089
tert-butyl N-[3-[3-[3-(4-methylphenyl)propanoylamino]anilino]-3-oxopropyl]carbamate (PubChem CID 108920089) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[3-(4-methylphenyl)propanoylamino]anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[3-(4-methylphenyl)propanoylamino]anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108920089 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | tert-butyl N-[3-[3-[3-(4-methylphenyl)propanoylamino]anilino]-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(CCC(=O)Nc2cccc(NC(=O)CCNC(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-17-8-10-18(11-9-17)12-13-21(28)26-19-6-5-7-20(16-19)27-22(29)14-15-25-23(30)31-24(2,3)4/h5-11,16H,12-15H2,1-4H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | JCMYTKHKEWPNQM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |