C18H27N3O4 — CID 108917175
tert-butyl N-[2-oxo-2-[3-(pentanoylamino)anilino]ethyl]carbamate (PubChem CID 108917175) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[3-(pentanoylamino)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[3-(pentanoylamino)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 108917175 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[3-(pentanoylamino)anilino]ethyl]carbamate |
| SMILES | CCCCC(=O)Nc1cccc(NC(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H27N3O4/c1-5-6-10-15(22)20-13-8-7-9-14(11-13)21-16(23)12-19-17(24)25-18(2,3)4/h7-9,11H,5-6,10,12H2,1-4H3,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | PDXRHUZVZIXUHY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |