C19H27N3O4 — CID 108917276
tert-butyl N-[2-[3-[[(E)-3-methylpent-2-enoyl]amino]anilino]-2-oxoethyl]carbamate (PubChem CID 108917276) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[(E)-3-methylpent-2-enoyl]amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[(E)-3-methylpent-2-enoyl]amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917276 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl N-[2-[3-[[(E)-3-methylpent-2-enoyl]amino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC/C(C)=C/C(=O)Nc1cccc(NC(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H27N3O4/c1-6-13(2)10-16(23)21-14-8-7-9-15(11-14)22-17(24)12-20-18(25)26-19(3,4)5/h7-11H,6,12H2,1-5H3,(H,20,25)(H,21,23)(H,22,24)/b13-10+ |
| InChIKey | CSMWEWDLSUBNEY-JLHYYAGUSA-N |
| XLogP | 3.44 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|