C26H35N3O7 — CID 108917111
tert-butyl N-[2-oxo-2-[3-[(3,4,5-triethoxybenzoyl)amino]anilino]ethyl]carbamate (PubChem CID 108917111) has the molecular formula C26H35N3O7 and a molecular weight of 501.58 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[3-[(3,4,5-triethoxybenzoyl)amino]anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[3-[(3,4,5-triethoxybenzoyl)amino]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 108917111 |
| Molecular Formula | C26H35N3O7 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[3-[(3,4,5-triethoxybenzoyl)amino]anilino]ethyl]carbamate |
| SMILES | CCOc1cc(C(=O)Nc2cccc(NC(=O)CNC(=O)OC(C)(C)C)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H35N3O7/c1-7-33-20-13-17(14-21(34-8-2)23(20)35-9-3)24(31)29-19-12-10-11-18(15-19)28-22(30)16-27-25(32)36-26(4,5)6/h10-15H,7-9,16H2,1-6H3,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | OTWSLTFBVCEOAO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |