C23H29N3O6 — CID 108917139
tert-butyl N-[2-[3-[[2-(2-ethoxyphenoxy)acetyl]amino]anilino]-2-oxoethyl]carbamate (PubChem CID 108917139) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[2-(2-ethoxyphenoxy)acetyl]amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[2-(2-ethoxyphenoxy)acetyl]amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917139 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | tert-butyl N-[2-[3-[[2-(2-ethoxyphenoxy)acetyl]amino]anilino]-2-oxoethyl]carbamate |
| SMILES | CCOc1ccccc1OCC(=O)Nc1cccc(NC(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H29N3O6/c1-5-30-18-11-6-7-12-19(18)31-15-21(28)26-17-10-8-9-16(13-17)25-20(27)14-24-22(29)32-23(2,3)4/h6-13H,5,14-15H2,1-4H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | COLCGCCGIWRMGY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |