C23H28ClN3O5 — CID 108917155
tert-butyl N-[2-[3-[4-(2-chlorophenoxy)butanoylamino]anilino]-2-oxoethyl]carbamate (PubChem CID 108917155) has the molecular formula C23H28ClN3O5 and a molecular weight of 461.95 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[4-(2-chlorophenoxy)butanoylamino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[4-(2-chlorophenoxy)butanoylamino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917155 |
| Molecular Formula | C23H28ClN3O5 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | tert-butyl N-[2-[3-[4-(2-chlorophenoxy)butanoylamino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1cccc(NC(=O)CCCOc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H28ClN3O5/c1-23(2,3)32-22(30)25-15-21(29)27-17-9-6-8-16(14-17)26-20(28)12-7-13-31-19-11-5-4-10-18(19)24/h4-6,8-11,14H,7,12-13,15H2,1-3H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | KQBYLCKBDFOCAA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|