C24H29BrClN3O5 — CID 108920247
tert-butyl N-[3-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]anilino]-3-oxopropyl]carbamate (PubChem CID 108920247) has the molecular formula C24H29BrClN3O5 and a molecular weight of 554.87 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108920247 |
| Molecular Formula | C24H29BrClN3O5 |
| Molecular Weight | 554.87 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | tert-butyl N-[3-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]anilino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1ccccc1NC(=O)CCCOc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C24H29BrClN3O5/c1-24(2,3)34-23(32)27-13-12-22(31)29-19-8-5-4-7-18(19)28-21(30)9-6-14-33-20-11-10-16(25)15-17(20)26/h4-5,7-8,10-11,15H,6,9,12-14H2,1-3H3,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | CCFZYCQGABOZAR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|