C14H18BrNO4 — CID 126961724
tert-butyl N-[2-(4-bromo-2-formylphenoxy)ethyl]carbamate (PubChem CID 126961724) has the molecular formula C14H18BrNO4 and a molecular weight of 344.21 g/mol. Its IUPAC name is tert-butyl N-[2-(4-bromo-2-formylphenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-bromo-2-formylphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 126961724 |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | tert-butyl N-[2-(4-bromo-2-formylphenoxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(Br)cc1C=O |
| InChI | InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(18)16-6-7-19-12-5-4-11(15)8-10(12)9-17/h4-5,8-9H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | OPIDCOPMWIELBM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|