C19H28BrNO4 — CID 129292450
tert-butyl N-[(2S)-1-(4-bromo-2-formylphenoxy)-2,4-dimethylpentan-2-yl]carbamate (PubChem CID 129292450) has the molecular formula C19H28BrNO4 and a molecular weight of 414.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4-bromo-2-formylphenoxy)-2,4-dimethylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(4-bromo-2-formylphenoxy)-2,4-dimethylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 129292450 |
| Molecular Formula | C19H28BrNO4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4-bromo-2-formylphenoxy)-2,4-dimethylpentan-2-yl]carbamate |
| SMILES | CC(C)C[C@@](C)(COc1ccc(Br)cc1C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28BrNO4/c1-13(2)10-19(6,21-17(23)25-18(3,4)5)12-24-16-8-7-15(20)9-14(16)11-22/h7-9,11,13H,10,12H2,1-6H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | KHIQCXVMQUOFCT-IBGZPJMESA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|