C17H26ClIN2O3 — CID 146320127
tert-butyl N-[1-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamate (PubChem CID 146320127) has the molecular formula C17H26ClIN2O3 and a molecular weight of 468.76 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 146320127 |
| Molecular Formula | C17H26ClIN2O3 |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | tert-butyl N-[1-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamate |
| SMILES | CC(C)CC(C)(COc1ccc(I)nc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26ClIN2O3/c1-11(2)9-17(6,21-15(22)24-16(3,4)5)10-23-12-7-8-13(19)20-14(12)18/h7-8,11H,9-10H2,1-6H3,(H,21,22) |
| InChIKey | VFWMQRKYZWKUMN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|