C13H18ClIN2O3 — CID 118420070
[5-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamic acid (PubChem CID 118420070) has the molecular formula C13H18ClIN2O3 and a molecular weight of 412.66 g/mol. Its IUPAC name is [5-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamic acid.
| Compound Name | [5-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118420070 |
| Molecular Formula | C13H18ClIN2O3 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | [5-[(2-chloro-6-iodo-3-pyridinyl)oxy]-2,4-dimethylpentan-2-yl]carbamic acid |
| SMILES | CC(COc1ccc(I)nc1Cl)CC(C)(C)NC(=O)O |
| InChI | InChI=1S/C13H18ClIN2O3/c1-8(6-13(2,3)17-12(18)19)7-20-9-4-5-10(15)16-11(9)14/h4-5,8,17H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | DCKYVSRDMLXPKF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|