C19H20BrNO5 — CID 27874519
2-(4-bromo-2-formylphenoxy)-N-[2-(4-ethoxyphenoxy)ethyl]acetamide (PubChem CID 27874519) has the molecular formula C19H20BrNO5 and a molecular weight of 422.28 g/mol. Its IUPAC name is 2-(4-bromo-2-formylphenoxy)-N-[2-(4-ethoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-(4-bromo-2-formylphenoxy)-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 27874519 |
| Molecular Formula | C19H20BrNO5 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-(4-bromo-2-formylphenoxy)-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
| SMILES | CCOc1ccc(OCCNC(=O)COc2ccc(Br)cc2C=O)cc1 |
| InChI | InChI=1S/C19H20BrNO5/c1-2-24-16-4-6-17(7-5-16)25-10-9-21-19(23)13-26-18-8-3-15(20)11-14(18)12-22/h3-8,11-12H,2,9-10,13H2,1H3,(H,21,23) |
| InChIKey | LTHMUYRYSJZEIU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|