C20H23NO6 — CID 34060908
N-[2-(4-ethoxyphenoxy)ethyl]-2-(4-formyl-2-methoxyphenoxy)acetamide (PubChem CID 34060908) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenoxy)ethyl]-2-(4-formyl-2-methoxyphenoxy)acetamide.
| Compound Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-(4-formyl-2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 34060908 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-(4-formyl-2-methoxyphenoxy)acetamide |
| SMILES | CCOc1ccc(OCCNC(=O)COc2ccc(C=O)cc2OC)cc1 |
| InChI | InChI=1S/C20H23NO6/c1-3-25-16-5-7-17(8-6-16)26-11-10-21-20(23)14-27-18-9-4-15(13-22)12-19(18)24-2/h4-9,12-13H,3,10-11,14H2,1-2H3,(H,21,23) |
| InChIKey | JROMLYIQIXXLPE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|