C11H12N2O5 — CID 24694058
N-carbamoyl-2-(4-formyl-2-methoxyphenoxy)acetamide (PubChem CID 24694058) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is N-carbamoyl-2-(4-formyl-2-methoxyphenoxy)acetamide.
| Compound Name | N-carbamoyl-2-(4-formyl-2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 24694058 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-carbamoyl-2-(4-formyl-2-methoxyphenoxy)acetamide |
| SMILES | COc1cc(C=O)ccc1OCC(=O)NC(N)=O |
| InChI | InChI=1S/C11H12N2O5/c1-17-9-4-7(5-14)2-3-8(9)18-6-10(15)13-11(12)16/h2-5H,6H2,1H3,(H3,12,13,15,16) |
| InChIKey | GYIHKZAQSNSUIG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|