C16H15NO4 — CID 7611771
2-(5-formyl-2-methoxyphenoxy)-N-phenylacetamide (PubChem CID 7611771) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-(5-formyl-2-methoxyphenoxy)-N-phenylacetamide.
| Compound Name | 2-(5-formyl-2-methoxyphenoxy)-N-phenylacetamide |
|---|---|
| PubChem CID | 7611771 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(5-formyl-2-methoxyphenoxy)-N-phenylacetamide |
| SMILES | COc1ccc(C=O)cc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H15NO4/c1-20-14-8-7-12(10-18)9-15(14)21-11-16(19)17-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,17,19) |
| InChIKey | WUAKQEJNQPDLPX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|