C18H19NO4 — CID 7611853
2-(5-formyl-2-methoxyphenoxy)-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 7611853) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(5-formyl-2-methoxyphenoxy)-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-(5-formyl-2-methoxyphenoxy)-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 7611853 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(5-formyl-2-methoxyphenoxy)-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | COc1ccc(C=O)cc1OCC(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H19NO4/c1-13(15-6-4-3-5-7-15)19-18(21)12-23-17-10-14(11-20)8-9-16(17)22-2/h3-11,13H,12H2,1-2H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | LSBFHEWEJLXDLQ-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|