C26H24N2O4 — CID 1304469
2-[2-methoxy-4-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 1304469) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[2-methoxy-4-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 1304469 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | COc1cc(/C=C2\C(=O)Nc3ccccc32)ccc1OCC(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H24N2O4/c1-17(19-8-4-3-5-9-19)27-25(29)16-32-23-13-12-18(15-24(23)31-2)14-21-20-10-6-7-11-22(20)28-26(21)30/h3-15,17H,16H2,1-2H3,(H,27,29)(H,28,30)/b21-14-/t17-/m0/s1 |
| InChIKey | FYEJKQDFPYZNNR-XESZTULISA-N |
| XLogP | 4.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|