C23H19NO3 — CID 2357044
(3E)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 2357044) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3E)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 2357044 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (3E)-3-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2/C(=O)Nc3ccccc32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H19NO3/c1-26-22-14-17(11-12-21(22)27-15-16-7-3-2-4-8-16)13-19-18-9-5-6-10-20(18)24-23(19)25/h2-14H,15H2,1H3,(H,24,25)/b19-13+ |
| InChIKey | JUMOAKISAVETQS-CPNJWEJPSA-N |
| XLogP | 4.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|